CAS 2089257-49-6 is the registry number for 2,5,6-Trimethyl-3-pyridinamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 250mg, 5g.
2,5,6-trimethylpyridin-3-amine;dihydrochloride (CAS 2089257-49-6) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: 2,5,6-trimethylpyridin-3-amine;dihydrochloride. InChIKey: WWRNYJZSMMGKJE-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 2,5,6-trimethylpyridin-3-amine;dihydrochloride |
| InChIKey | WWRNYJZSMMGKJE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1C)C)N.Cl.Cl |
Computed by PubChem (NCBI)