cas: 669713-73-9 — see every product listed under this CAS number, including other names
2-(3'-Methoxy-[1,1'-biphenyl]-4-yl)acetic acid 98% (CAS 669713-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A293929-250mg |
| cas | 669713-73-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1199.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A293929 |
2-[4-(3-methoxyphenyl)phenyl]acetic acid (CAS 669713-73-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-[4-(3-methoxyphenyl)phenyl]acetic acid. InChIKey: RWCAHCLLXAXLGN-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-[4-(3-methoxyphenyl)phenyl]acetic acid |
| InChIKey | RWCAHCLLXAXLGN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)