cas: 298690-82-1 — see every product listed under this CAS number, including other names
2-(3,4-Dichloro-phenyl)-pyrrolidine (CAS 298690-82-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 2,5g, 1g, 5g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | YLA69082-250mg |
| cas | 298690-82-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 250mg | price on request | |
| Biosynth | 2,5g | price on request | |
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5355.42 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
2-(3,4-dichlorophenyl)pyrrolidine (CAS 298690-82-1) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)pyrrolidine. InChIKey: LTITXVXGJJQFJC-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)pyrrolidine |
| InChIKey | LTITXVXGJJQFJC-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)