cas: 408492-26-2 — see every product listed under this CAS number, including other names
2-(3,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 408492-26-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D8P6-1g |
| cas | 408492-26-2 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 347.60 Pln | |
| Chemat | 25g | 664.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 408492-26-2) is a chemical compound with the molecular formula C12H15BBr2O2 and a molecular weight of 361.87 g/mol. IUPAC name: 2-(3,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WJYKUCWENIHKOC-UHFFFAOYSA-N.
| Molecular formula | C12H15BBr2O2 |
|---|---|
| Molecular weight | 361.87 g/mol |
| IUPAC name | 2-(3,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WJYKUCWENIHKOC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)