cas: 890839-37-9 — see every product listed under this CAS number, including other names
2-(3,5-Difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 890839-37-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A787011-250mg |
| cas | 890839-37-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1160.25 Pln | |
| Ambeed | 5g | 4386.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A787011 |
2-(3,5-difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 890839-37-9) is a chemical compound with the molecular formula C13H17BF2O3 and a molecular weight of 270.08 g/mol. IUPAC name: 2-(3,5-difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LVDNSBZUAAXPPZ-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 2-(3,5-difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LVDNSBZUAAXPPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)OC)F |
Computed by PubChem (NCBI)