cas: 863868-36-4 — see every product listed under this CAS number, including other names
2-(3,5-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T) (CAS 863868-36-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5017-1G |
| cas | 863868-36-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 172.43 Pln | |
| TCI | 5g | 521.56 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 863868-36-4) is a chemical compound with the molecular formula C12H15BF2O2 and a molecular weight of 240.06 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NBMGRDOMOTUSOT-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O2 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NBMGRDOMOTUSOT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)