cas: 14202-14-3 — see every product listed under this CAS number, including other names
2-(3,5-Dimethyladamantan-1-yl)acetic acid, ≥97%, ≥97% (CAS 14202-14-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112HKS-1g |
| cas | 14202-14-3 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1451.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-(3,5-dimethyl-1-adamantyl)acetic acid (CAS 14202-14-3) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 2-(3,5-dimethyl-1-adamantyl)acetic acid. InChIKey: FUOXJVUIQUYDDI-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 2-(3,5-dimethyl-1-adamantyl)acetic acid |
| InChIKey | FUOXJVUIQUYDDI-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)CC(=O)O)C |
Computed by PubChem (NCBI)