CAS 1139-46-4 appears in our catalog under these names: 4–(2,4,4–Trimethylpentan–2–yl)benzene–1,2–diol, 4-(2,4,4-Trimethylpentan-2-yl)benzene-1,2-diol, 95%, 4-(2,4,4-Trimethylpentan-2-yl)benzene-1,2-diol, >95% (HPLC), 4-(2,4,4-Trimethylpentan-2-yl)benzene-1,2-diol 95%. Offered by: GLPBio, Combi-blocks, TRC, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10mg, 25mg.
4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol (CAS 1139-46-4) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol. InChIKey: BOTKTAZUSYVSFF-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol |
| InChIKey | BOTKTAZUSYVSFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)