CAS 28122-52-3 appears in our catalog under these names: 4-tert-Octylresorcinol, 95%, 4–tert–Octylresorcinol, 4-tert-Octylresorcinol, >99.0%(GC), 4-(2,4,4-Trimethylpentan-2-yl)benzene-1,3-diol, 97%, 97%, 4-(1,1,3,3-tetramethylbutyl)benzene-1,3-diol, 99%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 250mg.
4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol (CAS 28122-52-3) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol. InChIKey: YQOJNENEFSZINP-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4-(2,4,4-trimethylpentan-2-yl)benzene-1,3-diol |
| InChIKey | YQOJNENEFSZINP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=C(C=C(C=C1)O)O |
Computed by PubChem (NCBI)