cas: 2246802-64-0 — see every product listed under this CAS number, including other names
2-(3-((4-Chlorophenoxy)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 2246802-64-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F761662-100MG |
| cas | 2246802-64-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1507.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-[(4-chlorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246802-64-0) is a chemical compound with the molecular formula C19H22BClO3 and a molecular weight of 344.6 g/mol. IUPAC name: 2-[3-[(4-chlorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SWLWOQLQZZZCQP-UHFFFAOYSA-N.
| Molecular formula | C19H22BClO3 |
|---|---|
| Molecular weight | 344.6 g/mol |
| IUPAC name | 2-[3-[(4-chlorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SWLWOQLQZZZCQP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)COC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)