CAS 2093152-46-4 is the registry number for 2-(4-(Benzyloxy)-3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-(3-chloro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2093152-46-4) is a chemical compound with the molecular formula C19H22BClO3 and a molecular weight of 344.6 g/mol. IUPAC name: 2-(3-chloro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZAQHCZGWQVSJIP-UHFFFAOYSA-N.
| Molecular formula | C19H22BClO3 |
|---|---|
| Molecular weight | 344.6 g/mol |
| IUPAC name | 2-(3-chloro-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZAQHCZGWQVSJIP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)