Products 2096332-64-6
CAS 2096332-64-6 appears in our catalog under these names: 2-(3-((3-Chlorophenoxy)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 3-(3-Chlorophenoxymethyl)phenylboronic acid pinacol ester, 96%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-[3-[(3-chlorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096332-64-6) is a chemical compound with the molecular formula C19H22BClO3 and a molecular weight of 344.6 g/mol. IUPAC name: 2-[3-[(3-chlorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RTGPYTZDTNEAIE-UHFFFAOYSA-N.
| Molecular formula | C19H22BClO3 |
|---|---|
| Molecular weight | 344.6 g/mol |
| IUPAC name | 2-[3-[(3-chlorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RTGPYTZDTNEAIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)COC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)