cas: 1073353-91-9 — see every product listed under this CAS number, including other names
2-(3-(2-Bromoethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 1073353-91-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213422-250MG |
| cas | 1073353-91-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 1788.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-(2-bromoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073353-91-9) is a chemical compound with the molecular formula C14H20BBrO3 and a molecular weight of 327.02 g/mol. IUPAC name: 2-[3-(2-bromoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AFIJFVBZZHBRBB-UHFFFAOYSA-N.
| Molecular formula | C14H20BBrO3 |
|---|---|
| Molecular weight | 327.02 g/mol |
| IUPAC name | 2-[3-(2-bromoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AFIJFVBZZHBRBB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCBr |
Computed by PubChem (NCBI)