CAS 1073339-03-3 appears in our catalog under these names: 3-Bromo-5-ethoxyphenylboronic acid, pinacol ester, 98%, 2-(3-Bromo-5-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 3-Bromo-5-ethoxyphenylboronic acid, pinacol ester, 98%, 98%, 2-(3-Bromo-5-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-(3-bromo-5-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073339-03-3) is a chemical compound with the molecular formula C14H20BBrO3 and a molecular weight of 327.02 g/mol. IUPAC name: 2-(3-bromo-5-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JPVRJWZQGKYTEV-UHFFFAOYSA-N.
| Molecular formula | C14H20BBrO3 |
|---|---|
| Molecular weight | 327.02 g/mol |
| IUPAC name | 2-(3-bromo-5-ethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JPVRJWZQGKYTEV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)OCC |
Computed by PubChem (NCBI)