CAS 1073353-91-9 appears in our catalog under these names: 3-(2-Bromoethoxy)phenylboronic acid, pinacol ester, 98%, 2-(3-(2-Bromoethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(3-(2-Bromoethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-[3-(2-bromoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073353-91-9) is a chemical compound with the molecular formula C14H20BBrO3 and a molecular weight of 327.02 g/mol. IUPAC name: 2-[3-(2-bromoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AFIJFVBZZHBRBB-UHFFFAOYSA-N.
| Molecular formula | C14H20BBrO3 |
|---|---|
| Molecular weight | 327.02 g/mol |
| IUPAC name | 2-[3-(2-bromoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AFIJFVBZZHBRBB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCBr |
Computed by PubChem (NCBI)