cas: 223799-25-5 — see every product listed under this CAS number, including other names
2-(3-(Bromomethyl)phenyl)-5,5-dimethyl-1,3,2-dioxaborinane 98% (CAS 223799-25-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A724918-250mg |
| cas | 223799-25-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 670.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A724918 |
2-[3-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane (CAS 223799-25-5) is a chemical compound with the molecular formula C12H16BBrO2 and a molecular weight of 282.97 g/mol. IUPAC name: 2-[3-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: YMHOSDXBNPFLLT-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO2 |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-[3-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | YMHOSDXBNPFLLT-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)CBr |
Computed by PubChem (NCBI)