CAS 1092060-78-0 appears in our catalog under these names: 2-(4-Bromophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane, 95%, 2-(4-Bromophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 1g, 5g, 25g, 50g, 100g, 200g, 300g.
2-(4-bromophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane (CAS 1092060-78-0) is a chemical compound with the molecular formula C12H16BBrO2 and a molecular weight of 282.97 g/mol. IUPAC name: 2-(4-bromophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane. InChIKey: PRUASQKAECKLGK-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO2 |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
| InChIKey | PRUASQKAECKLGK-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)