CAS 223799-25-5 appears in our catalog under these names: 3-Bromomethylphenylboronic acid, neopentyl glycol ester, 98%, (3–BROMOMETHYLPHENYL)BORONIC ACID NEOPENTYL GLYCOL ESTER. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
2-[3-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane (CAS 223799-25-5) is a chemical compound with the molecular formula C12H16BBrO2 and a molecular weight of 282.97 g/mol. IUPAC name: 2-[3-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: YMHOSDXBNPFLLT-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO2 |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-[3-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | YMHOSDXBNPFLLT-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)CBr |
Computed by PubChem (NCBI)