cas: 1250996-75-8 — see every product listed under this CAS number, including other names
2-(3-(tert-Butoxycarbonyl)-3-azabicyclo-(3.2.1)octan-8-yl)acetic acid, 97% (CAS 1250996-75-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A278018-10g |
| cas | 1250996-75-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 32626.51 Pln | |
| AmBeed | 1g | 8526.49 Pln | |
| AmBeed | 5g | 19600.00 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.1]octan-8-yl]acetic acid (CAS 1250996-75-8) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.1]octan-8-yl]acetic acid. InChIKey: DCRMSHLCTZMJHG-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azabicyclo[3.2.1]octan-8-yl]acetic acid |
| InChIKey | DCRMSHLCTZMJHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C1)C2CC(=O)O |
Computed by PubChem (NCBI)