Products 1638765-40-8

CAS 1638765-40-8 is the registry number for 2–tert–butyl 8–ethyl 2–azaspiro(4·5)decane–2,8–dicarboxylate. Offered by: GLPBio. Available pack sizes: 200mg.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 8-O-ethyl 2-azaspiro[4.5]decane-2,8-dicarboxylate (CAS 1638765-40-8) is a chemical compound with the molecular formula C17H29NO4 and a molecular weight of 311.4 g/mol. IUPAC name: 2-O-tert-butyl 8-O-ethyl 2-azaspiro[4.5]decane-2,8-dicarboxylate. InChIKey: UBSBRZXAXWQMHE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H29NO4
Molecular weight311.4 g/mol
IUPAC name2-O-tert-butyl 8-O-ethyl 2-azaspiro[4.5]decane-2,8-dicarboxylate
InChIKeyUBSBRZXAXWQMHE-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCC2(CC1)CCN(C2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)