CAS 128305-29-3 is the registry number for (2E,4Z)-Deca-2,4-dien-oyl (R)-Carnitine Inner Salt. Offered by: TRC. Available pack sizes: 25mg.
(3R)-3-[(2E,4Z)-deca-2,4-dienoyl]oxy-4-(trimethylazaniumyl)butanoate (CAS 128305-29-3) is a chemical compound with the molecular formula C17H29NO4 and a molecular weight of 311.4 g/mol. IUPAC name: (3R)-3-[(2E,4Z)-deca-2,4-dienoyl]oxy-4-(trimethylazaniumyl)butanoate. InChIKey: URTBCBICNCMCPB-CWUOWYQYSA-N.
| Molecular formula | C17H29NO4 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | (3R)-3-[(2E,4Z)-deca-2,4-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| InChIKey | URTBCBICNCMCPB-CWUOWYQYSA-N |
| SMILES | CCCCC/C=C\C=C\C(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
Computed by PubChem (NCBI)