CAS 77771-04-1 appears in our catalog under these names: 2-(3-Bromo-4-fluorophenyl)-1,3-dioxolane, 95%, 2–(3–Bromo–4–fluorophenyl)–1,3–dioxolane, 2-(3-Bromo-4-fluorophenyl)-1,3-dioxolane, 95%+, 95%+, 2-(3-Bromo-4-fluorophenyl)-1,3-dioxolane, >95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 1g, 5g, 250mg, 100mg, 100g.
2-(3-bromo-4-fluorophenyl)-1,3-dioxolane (CAS 77771-04-1) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 2-(3-bromo-4-fluorophenyl)-1,3-dioxolane. InChIKey: OATOZCSPTSMOIY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 2-(3-bromo-4-fluorophenyl)-1,3-dioxolane |
| InChIKey | OATOZCSPTSMOIY-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)F)Br |
Computed by PubChem (NCBI)