CAS 940314-56-7 appears in our catalog under these names: 2-(4-Bromo-3-fluorophenyl)-1,3-dioxolane, 95%, 2-(4-Bromo-3-fluorophenyl)-1,3-dioxolane, 98%, 2-(4-Bromo-3-fluorophenyl)-1,3-dioxolane, 2-(4-Bromo-3-fluorophenyl)-1,3-dioxolane, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 100mg, 250mg.
2-(4-bromo-3-fluorophenyl)-1,3-dioxolane (CAS 940314-56-7) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 2-(4-bromo-3-fluorophenyl)-1,3-dioxolane. InChIKey: PQMLGQOAQAXEBH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 2-(4-bromo-3-fluorophenyl)-1,3-dioxolane |
| InChIKey | PQMLGQOAQAXEBH-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)