CAS 1131040-49-7 appears in our catalog under these names: Ethyl 2-bromo-3-fluorobenzoate, 95%, Ethyl 2-bromo-3-fluorobenzoate, 95+%, 2-Bromo-3-fluorobenzoic acid ethyl ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 25g.
Ethyl 2-bromo-3-fluorobenzoate (CAS 1131040-49-7) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: ethyl 2-bromo-3-fluorobenzoate. InChIKey: JCKZDYSLKOUKTG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | ethyl 2-bromo-3-fluorobenzoate |
| InChIKey | JCKZDYSLKOUKTG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)F)Br |
Computed by PubChem (NCBI)