2-(3-Bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 124215-44-7 — see every product listed under this CAS number, including other names
2-(3-Bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 124215-44-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238294-1G |
| cas | 124215-44-7 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 706.02 Pln | |
| Fluorochem | 25g | 2257.56 Pln | |
| Fluorochem | 100g | 8854.19 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 124215-44-7) is a chemical compound with the molecular formula C9H18BBrO2 and a molecular weight of 248.96 g/mol. IUPAC name: 2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CHQXFJUKMDJWHO-UHFFFAOYSA-N.
| Molecular formula | C9H18BBrO2 |
|---|---|
| Molecular weight | 248.96 g/mol |
| IUPAC name | 2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CHQXFJUKMDJWHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCBr |
Computed by PubChem (NCBI)