cas: 124215-44-7 — see every product listed under this CAS number, including other names
3-BROMOPROPYLBORONIC ACID, PINACOL ESTER, 97%, 97% (CAS 124215-44-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LOF-250mg |
| cas | 124215-44-7 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 592.40 Pln | |
| Chemat | 25g | 2411.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 124215-44-7) is a chemical compound with the molecular formula C9H18BBrO2 and a molecular weight of 248.96 g/mol. IUPAC name: 2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CHQXFJUKMDJWHO-UHFFFAOYSA-N.
| Molecular formula | C9H18BBrO2 |
|---|---|
| Molecular weight | 248.96 g/mol |
| IUPAC name | 2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CHQXFJUKMDJWHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCBr |
Computed by PubChem (NCBI)