cas: 124215-44-7 — see every product listed under this CAS number, including other names
2-(3-Bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 124215-44-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 433930050 |
| cas | 124215-44-7 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 717.17 Pln | |
| Thermo Scientific (Acros) | 1g | 223.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 124215-44-7) is a chemical compound with the molecular formula C9H18BBrO2 and a molecular weight of 248.96 g/mol. IUPAC name: 2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CHQXFJUKMDJWHO-UHFFFAOYSA-N.
| Molecular formula | C9H18BBrO2 |
|---|---|
| Molecular weight | 248.96 g/mol |
| IUPAC name | 2-(3-bromopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CHQXFJUKMDJWHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCBr |
Computed by PubChem (NCBI)