cas: 1245524-02-0 — see every product listed under this CAS number, including other names
2-(3-Chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 1245524-02-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691519-100MG |
| cas | 1245524-02-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 544.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1245524-02-0) is a chemical compound with the molecular formula C12H15BClFO2 and a molecular weight of 256.51 g/mol. IUPAC name: 2-(3-chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZYWCNKHMEUXNGS-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO2 |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-(3-chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZYWCNKHMEUXNGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)F |
Computed by PubChem (NCBI)