2-(3-Chlorophenyl)propan-2-amine hydrochloride
cas: 1216523-22-6 — see every product listed under this CAS number, including other names
2-(3-Chlorophenyl)propan-2-amine hydrochloride (CAS 1216523-22-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g. Offered by: Biosynth, Chemat, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | RYB52322-1g |
| cas | 1216523-22-6 |
| size | 1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Biosynth | 1g | price on request | |
| Biosynth | 10g | price on request | |
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 866.00 Pln | |
| Chemat | 5g | 2690.00 Pln | |
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 950.72 Pln | |
| Fluorochem | 1g | 2278.38 Pln | |
| Fluorochem | 5g | 6683.08 Pln |
properties
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
2-(3-chlorophenyl)propan-2-amine;hydrochloride (CAS 1216523-22-6) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: 2-(3-chlorophenyl)propan-2-amine;hydrochloride. InChIKey: DPLPZZFTPMLUPT-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | 2-(3-chlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | DPLPZZFTPMLUPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)Cl)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(3-Chlorophenyl)propan-2-amine hydrochloride, 2-(3-Chlorophenyl)propan-2-amine HCl, 2-(3-chlorophenyl)propan-2-amine;hydrochloride, 3-Chloro-alpha,alpha-dimethylbenzylamine hydrochloride, 1-(3-Chlorophenyl)-1-methylethylamine HCl, 2-(3-Chlorophenyl)propan-2-aminehydrochloride, 1-(3-Chlorophenyl)-1-methylethylamine hydrochloride