CAS 1255306-36-5 appears in our catalog under these names: (R)-1-(4-Chloro-3-methylphenyl)ethanamine hydrochloride, 95%, (R)–1–(4–Chloro–3–methylphenyl)ethanamine hydrochloride, (R)-1-(4-Chloro-3-methylphenyl)ethanamine hydrochloride, 97%, 97%, (R)-1-(4-Chloro-3-methylphenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R)-1-(4-chloro-3-methylphenyl)ethanamine;hydrochloride (CAS 1255306-36-5) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: (1R)-1-(4-chloro-3-methylphenyl)ethanamine;hydrochloride. InChIKey: RMJLPGIVLDGISK-OGFXRTJISA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | (1R)-1-(4-chloro-3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | RMJLPGIVLDGISK-OGFXRTJISA-N |
| SMILES | CC1=C(C=CC(=C1)[C@@H](C)N)Cl.Cl |
Computed by PubChem (NCBI)