CAS 1216523-22-6 appears in our catalog under these names: 2-(3-Chlorophenyl)propan-2-amine hydrochloride, 98%, 2–(3–chlorophenyl)propan–2–amine hydrochloride, 2-(3-Chlorophenyl)propan-2-amine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
2-(3-chlorophenyl)propan-2-amine;hydrochloride (CAS 1216523-22-6) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: 2-(3-chlorophenyl)propan-2-amine;hydrochloride. InChIKey: DPLPZZFTPMLUPT-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | 2-(3-chlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | DPLPZZFTPMLUPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)Cl)N.Cl |
Computed by PubChem (NCBI)