cas: 1035690-24-4 — see every product listed under this CAS number, including other names
2-(3-Cyclopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1035690-24-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F335512-100MG |
| cas | 1035690-24-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-cyclopropyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1035690-24-4) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 2-(3-cyclopropyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QRRJFVBHNJSHKB-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 2-(3-cyclopropyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QRRJFVBHNJSHKB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OC3CC3 |
Computed by PubChem (NCBI)