CAS 1035690-24-4 appears in our catalog under these names: 3-Cyclopropoxyphenylboronic acid pinacol ester, 97%, 2-(3-(Cyclopropyloxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%, 3-Cyclopropoxyphenylboronic acid pinacol ester, 2-(3-Cyclopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, 2-(3-Cyclopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 2,5g, 25g, 50g, 0,5g.
2-(3-cyclopropyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1035690-24-4) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 2-(3-cyclopropyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QRRJFVBHNJSHKB-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 2-(3-cyclopropyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QRRJFVBHNJSHKB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OC3CC3 |
Computed by PubChem (NCBI)