CAS 1467060-42-9 is the registry number for (1-[4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]cyclopropylmethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]cyclopropyl]methanol (CAS 1467060-42-9) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: [1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]cyclopropyl]methanol. InChIKey: OPHLTHDWGBWRLK-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | [1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]cyclopropyl]methanol |
| InChIKey | OPHLTHDWGBWRLK-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C3(CC3)CO |
Computed by PubChem (NCBI)