cas: 1350426-06-0 — see every product listed under this CAS number, including other names
2-(3-Fluoro-4-(1-methylethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97% (CAS 1350426-06-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC336-95-97-1g |
| cas | 1350426-06-0 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 4027.54 Pln | |
| Hoffman Fine Chemicals | 2,5g | 6821.98 Pln | |
| Hoffman Fine Chemicals | 5g | 10726.54 Pln | |
| Hoffman Fine Chemicals | 10g | 16978.94 Pln | |
| Hoffman Fine Chemicals | 25g | 35736.14 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(3-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1350426-06-0) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(3-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BVYVWKIIVJNFLU-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(3-fluoro-4-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BVYVWKIIVJNFLU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC(C)C)F |
Computed by PubChem (NCBI)