cas: 850881-09-3 — see every product listed under this CAS number, including other names
2-(3-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850881-09-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318061-100MG |
| cas | 850881-09-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 591.48 Pln | |
| Fluorochem | 5g | 1257.91 Pln |
| delivery time | 3-4 weeks |
|---|
2-(3-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850881-09-3) is a chemical compound with the molecular formula C16H27BO2S and a molecular weight of 294.3 g/mol. IUPAC name: 2-(3-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XCXAUPBHQCCWCI-UHFFFAOYSA-N.
| Molecular formula | C16H27BO2S |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 2-(3-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XCXAUPBHQCCWCI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)CCCCCC |
Computed by PubChem (NCBI)