CAS 917985-54-7 appears in our catalog under these names: 5-Hexylthiophene-2-boronic acid, pinacol ester, 95%, 5-Hexyl-2-thiopheneboronic acid pinacol ester, 95-<97%, 5–Hexyl–2–thiopheneboronic acid pinacol ester, 2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, 5-HEXYL-2-THIOPHENEBORONIC ACID PINACOL&. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 25g, 50g, 100g, 200g, 300g.
2-(5-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 917985-54-7) is a chemical compound with the molecular formula C16H27BO2S and a molecular weight of 294.3 g/mol. IUPAC name: 2-(5-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FWZQTJFOKCBQGX-UHFFFAOYSA-N.
| Molecular formula | C16H27BO2S |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 2-(5-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FWZQTJFOKCBQGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CCCCCC |
Computed by PubChem (NCBI)