CAS 850881-09-3 appears in our catalog under these names: 3-HEXYLTHIOPHENE-2-BORONIC ACID PINACOL&, 3-Hexylthiophene-2-boronic acid, pinacol ester, 95%, 3-Hexylthiophene-2-boronic acid pinacol ester, 95-<97%, 3-Hexylthiophene-2-boronic acid pinacol ester, ≥97-<99%, 3–Hexyl–2–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)thiophene. Offered by: Sigma-Aldrich, Combi-blocks, Hoffman Fine Chemicals, GLPBio, TCI. Available pack sizes: 1G, 5G, 25g, 50g, 100g, 200g, 300g, 400g.
2-(3-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850881-09-3) is a chemical compound with the molecular formula C16H27BO2S and a molecular weight of 294.3 g/mol. IUPAC name: 2-(3-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XCXAUPBHQCCWCI-UHFFFAOYSA-N.
| Molecular formula | C16H27BO2S |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 2-(3-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XCXAUPBHQCCWCI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)CCCCCC |
Computed by PubChem (NCBI)