cas: 1789703-37-2 — see every product listed under this CAS number, including other names
2-(3-Hydroxyadamantan-1-yl)-1-iminohexahydropyrrolo[1,2-a]pyrazin-4(1H)-one, 95%, 95% (CAS 1789703-37-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V2JT-50mg |
| cas | 1789703-37-2 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 678.80 Pln | |
| Chemat | 100mg | 1110.80 Pln | |
| Chemat | 250mg | 1840.40 Pln | |
| Chemat | 1g | 5080.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3-hydroxy-1-adamantyl)-1-imino-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-4-one (CAS 1789703-37-2) is a chemical compound with the molecular formula C17H25N3O2 and a molecular weight of 303.4 g/mol. IUPAC name: 2-(3-hydroxy-1-adamantyl)-1-imino-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-4-one. InChIKey: ZZYCWDSBZNHPIN-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 2-(3-hydroxy-1-adamantyl)-1-imino-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-4-one |
| InChIKey | ZZYCWDSBZNHPIN-UHFFFAOYSA-N |
| SMILES | C1CC2C(=N)N(CC(=O)N2C1)C34CC5CC(C3)CC(C5)(C4)O |
Computed by PubChem (NCBI)