cas: 80457-74-5 — see every product listed under this CAS number, including other names
2-(3-Hydroxyphenyl)thiazolidine-4-carboxylic acid, 95+% (CAS 80457-74-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A295856-250mg |
| cas | 80457-74-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1271.50 Pln | |
| Ambeed | 1g | 3185.00 Pln | |
| Ambeed | 5g | 10343.94 Pln | |
| BLDpharm | 100mg | 786.41 Pln | |
| BLDpharm | 250mg | 1363.99 Pln | |
| BLDpharm | 1g | 3429.93 Pln | |
| BLDpharm | 5g | 11149.43 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
2-(3-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 80457-74-5) is a chemical compound with the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. IUPAC name: 2-(3-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: FJKZSYINEIIGCM-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 2-(3-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | FJKZSYINEIIGCM-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CC(=CC=C2)O)C(=O)O |
Computed by PubChem (NCBI)