CAS 2090010-35-6 is the registry number for Ethyl 7-oxo-6,7-dihydrothieno[3,2-c]pyridine-5(4h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ethyl 7-oxo-4,6-dihydrothieno[3,2-c]pyridine-5-carboxylate (CAS 2090010-35-6) is a chemical compound with the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. IUPAC name: ethyl 7-oxo-4,6-dihydrothieno[3,2-c]pyridine-5-carboxylate. InChIKey: RCFSYLRJMJJWIA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | ethyl 7-oxo-4,6-dihydrothieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | RCFSYLRJMJJWIA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CC2=C(C(=O)C1)SC=C2 |
Computed by PubChem (NCBI)