CAS 175136-92-2 appears in our catalog under these names: 5-Oxo-1-(2-thienylmethyl)pyrrolidine-3-carboxylic acid, 97%, 5-Oxo-1-(thiophen-2-ylmethyl)pyrrolidine-3-carboxylic acid, 95%, 5-Oxo-1-(2-thienylmethyl)pyrrolidine-3-carboxylic acid, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 25g, 1g, 5g, 10g.
5-oxo-1-(thiophen-2-ylmethyl)pyrrolidine-3-carboxylic acid (CAS 175136-92-2) is a chemical compound with the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. IUPAC name: 5-oxo-1-(thiophen-2-ylmethyl)pyrrolidine-3-carboxylic acid. InChIKey: HNEDKCTVOYJYQI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 5-oxo-1-(thiophen-2-ylmethyl)pyrrolidine-3-carboxylic acid |
| InChIKey | HNEDKCTVOYJYQI-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)