cas: 3783-77-5 — see every product listed under this CAS number, including other names
2-(3-OXOBUTYL)ISOINDOLINE-1,3-DIONE, 95% (CAS 3783-77-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306559-1G |
| cas | 3783-77-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 732.05 Pln | |
| Fluorochem | 25g | 2799.03 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-oxobutyl)isoindole-1,3-dione (CAS 3783-77-5) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 2-(3-oxobutyl)isoindole-1,3-dione. InChIKey: ONTXCMXICQNNNO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-(3-oxobutyl)isoindole-1,3-dione |
| InChIKey | ONTXCMXICQNNNO-UHFFFAOYSA-N |
| SMILES | CC(=O)CCN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)