CAS 91569-59-4 appears in our catalog under these names: 5-Methyl-3-(4-methylphenyl)isoxazole-4-carboxylic acid, 95%, 5-Methyl-3-(p-tolyl)isoxazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.
5-methyl-3-(4-methylphenyl)-1,2-oxazole-4-carboxylic acid (CAS 91569-59-4) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 5-methyl-3-(4-methylphenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: IAGFERXYANTCJG-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5-methyl-3-(4-methylphenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | IAGFERXYANTCJG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=C2C(=O)O)C |
Computed by PubChem (NCBI)