cas: 180576-05-0 — see every product listed under this CAS number, including other names
2-(4-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperazin-1-yl)acetic acid, 99.79% (CAS 180576-05-0) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 250 mg, 5 g, 25 g, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W087880-10 g |
| cas | 180576-05-0 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1485.34 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 983.78 Pln | |
| MedChemExpress | 25 g | 3356.87 Pln | |
| MedChemExpress | 500 mg | 310.40 Pln | |
| MedChemExpress | 1 g | 426.50 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.79% |
2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid (CAS 180576-05-0) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid. InChIKey: XNWPGFGLHGFRRP-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid |
| InChIKey | XNWPGFGLHGFRRP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)