Products 817173-11-8

CAS 817173-11-8 is the registry number for 2-((2-(Cyclohexylcarbamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[[2-(cyclohexylcarbamoyl)phenyl]carbamoyl]benzoic acid (CAS 817173-11-8) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: 2-[[2-(cyclohexylcarbamoyl)phenyl]carbamoyl]benzoic acid. InChIKey: UCFSBMQEPIWERG-UHFFFAOYSA-N.

Identity
Molecular formulaC21H22N2O4
Molecular weight366.4 g/mol
IUPAC name2-[[2-(cyclohexylcarbamoyl)phenyl]carbamoyl]benzoic acid
InChIKeyUCFSBMQEPIWERG-UHFFFAOYSA-N
SMILESC1CCC(CC1)NC(=O)C2=CC=CC=C2NC(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)