CAS 180576-05-0 appears in our catalog under these names: Fmoc-(4-carboxymethyl)piperazine, >95% (HPLC), 4–Fmoc–1–piperazineacetic acide, Fmoc-Cmpi-OH, 2-(4-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperazin-1-yl)acetic acid, 99.79%, 2-(4-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperazin-1-yl)acetic acid, 95%. Offered by: TRC, GLPBio, Iris Biotech, MedChemExpress, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10 g, 250 mg, 5 g, 25 g, 500 mg.
2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid (CAS 180576-05-0) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid. InChIKey: XNWPGFGLHGFRRP-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)piperazin-1-yl]acetic acid |
| InChIKey | XNWPGFGLHGFRRP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)