cas: 1415236-88-2 — see every product listed under this CAS number, including other names
2-(4-(Allyloxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (stabilized with BHT) (CAS 1415236-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A473555-250mg |
| cas | 1415236-88-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 1877.81 Pln |
| purity | 98% (stabilized with BHT) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A473555 |
4,4,5,5-tetramethyl-2-(4-prop-2-enoxyphenyl)-1,3,2-dioxaborolane (CAS 1415236-88-2) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-prop-2-enoxyphenyl)-1,3,2-dioxaborolane. InChIKey: VILPUDKKKJEDSO-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-prop-2-enoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | VILPUDKKKJEDSO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC=C |
Computed by PubChem (NCBI)