cas: 754226-40-9 — see every product listed under this CAS number, including other names
2-(4-(Benzyloxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 754226-40-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078673-10G |
| cas | 754226-40-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1158.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane (CAS 754226-40-9) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane. InChIKey: KMKOKPUXZWBMEI-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | KMKOKPUXZWBMEI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)