2-(4-(Benzyloxy)phenyl)-4，4，5，5-tetramethyl-1，3，2-dioxaborolane, 97%, 97%
cas: 754226-40-9 — see every product listed under this CAS number, including other names
2-(4-(Benzyloxy)phenyl)-4，4，5，5-tetramethyl-1，3，2-dioxaborolane, 97%, 97% (CAS 754226-40-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116L55-1g |
| cas | 754226-40-9 |
| size | 1g |
| availability | 145g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 100g | 894.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane (CAS 754226-40-9) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane. InChIKey: KMKOKPUXZWBMEI-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | KMKOKPUXZWBMEI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
2-(4-(Benzyloxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-[4-(benzyloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-(4-(phenylmethoxy)phenyl)-1,3,2-dioxaborolane, 4-Benzyloxyphenylboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-(4-phenylmethoxyphenyl)-1,3,2-dioxaborolane, 2-(4-Benzyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-(Benzyloxy)phenylboronic acid pinacol ester, 97%, 2-(4-(Benzyloxy)phenyl)-4455-tetramethyl-132-dioxaborolane, 4-Benzyloxybenzeneb, 4-Benzyloxyphenylboronic acid,pinacol ester